C17H26N2O5S — CID 87710793
(2R)-2-amino-2-(heptan-4-ylsulfonylmethyl)-3-(3-hydroxyphenyl)-3-oxopropanamide (PubChem CID 87710793) has the molecular formula C17H26N2O5S and a molecular weight of 370.47 g/mol. Its IUPAC name is (2R)-2-amino-2-(heptan-4-ylsulfonylmethyl)-3-(3-hydroxyphenyl)-3-oxopropanamide.
| Compound Name | (2R)-2-amino-2-(heptan-4-ylsulfonylmethyl)-3-(3-hydroxyphenyl)-3-oxopropanamide |
|---|---|
| PubChem CID | 87710793 |
| Molecular Formula | C17H26N2O5S |
| Molecular Weight | 370.47 g/mol |
| Exact Mass | 370.16 |
| IUPAC Name | (2R)-2-amino-2-(heptan-4-ylsulfonylmethyl)-3-(3-hydroxyphenyl)-3-oxopropanamide |
| SMILES | CCCC(CCC)S(=O)(=O)C[C@](N)(C(N)=O)C(=O)c1cccc(O)c1 |
| InChI | InChI=1S/C17H26N2O5S/c1-3-6-14(7-4-2)25(23,24)11-17(19,16(18)22)15(21)12-8-5-9-13(20)10-12/h5,8-10,14,20H,3-4,6-7,11,19H2,1-2H3,(H2,18,22)/t17-/m1/s1 |
| InChIKey | YUVDCRISBJNKNE-QGZVFWFLSA-N |
| XLogP | 1.14 |
| TPSA | 140.55 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.47 |
| LogP ≤ 5 | 1.14 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|