C16H15ClI2N4 — CID 87715347
2-[2-(3-chloro-2-iodophenyl)ethyl]-1-[(E)-(3-iodophenyl)methylideneamino]guanidine (PubChem CID 87715347) has the molecular formula C16H15ClI2N4 and a molecular weight of 552.59 g/mol. Its IUPAC name is 2-[2-(3-chloro-2-iodophenyl)ethyl]-1-[(E)-(3-iodophenyl)methylideneamino]guanidine.
| Compound Name | 2-[2-(3-chloro-2-iodophenyl)ethyl]-1-[(E)-(3-iodophenyl)methylideneamino]guanidine |
|---|---|
| PubChem CID | 87715347 |
| Molecular Formula | C16H15ClI2N4 |
| Molecular Weight | 552.59 g/mol |
| Exact Mass | 551.91 |
| IUPAC Name | 2-[2-(3-chloro-2-iodophenyl)ethyl]-1-[(E)-(3-iodophenyl)methylideneamino]guanidine |
| SMILES | N/C(=N\CCc1cccc(Cl)c1I)N/N=C/c1cccc(I)c1 |
| InChI | InChI=1S/C16H15ClI2N4/c17-14-6-2-4-12(15(14)19)7-8-21-16(20)23-22-10-11-3-1-5-13(18)9-11/h1-6,9-10H,7-8H2,(H3,20,21,23)/b22-10+ |
| InChIKey | ZMJYHPYSJOYTIG-LSHDLFTRSA-N |
| XLogP | 4.03 |
| TPSA | 62.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 552.59 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|