C14H10BrIN2O2 — CID 91540017
3-bromo-N-[(3-iodophenyl)methylideneamino]-6-oxocyclohexa-2,4-diene-1-carboxamide (PubChem CID 91540017) has the molecular formula C14H10BrIN2O2 and a molecular weight of 445.05 g/mol. Its IUPAC name is 3-bromo-N-[(3-iodophenyl)methylideneamino]-6-oxocyclohexa-2,4-diene-1-carboxamide.
| Compound Name | 3-bromo-N-[(3-iodophenyl)methylideneamino]-6-oxocyclohexa-2,4-diene-1-carboxamide |
|---|---|
| PubChem CID | 91540017 |
| Molecular Formula | C14H10BrIN2O2 |
| Molecular Weight | 445.05 g/mol |
| Exact Mass | 443.90 |
| IUPAC Name | 3-bromo-N-[(3-iodophenyl)methylideneamino]-6-oxocyclohexa-2,4-diene-1-carboxamide |
| SMILES | O=C1C=CC(Br)=CC1C(=O)NN=Cc1cccc(I)c1 |
| InChI | InChI=1S/C14H10BrIN2O2/c15-10-4-5-13(19)12(7-10)14(20)18-17-8-9-2-1-3-11(16)6-9/h1-8,12H,(H,18,20) |
| InChIKey | XOOUSBXFCOLNQD-UHFFFAOYSA-N |
| XLogP | 2.78 |
| TPSA | 58.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.05 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|