C11H9BrN4O2 — CID 98155129
(4S)-N-[(Z)-(3-bromophenyl)methylideneamino]-5-oxo-1,4-dihydropyrazole-4-carboxamide (PubChem CID 98155129) has the molecular formula C11H9BrN4O2 and a molecular weight of 309.12 g/mol. Its IUPAC name is (4S)-N-[(Z)-(3-bromophenyl)methylideneamino]-5-oxo-1,4-dihydropyrazole-4-carboxamide.
| Compound Name | (4S)-N-[(Z)-(3-bromophenyl)methylideneamino]-5-oxo-1,4-dihydropyrazole-4-carboxamide |
|---|---|
| PubChem CID | 98155129 |
| Molecular Formula | C11H9BrN4O2 |
| Molecular Weight | 309.12 g/mol |
| Exact Mass | 307.99 |
| IUPAC Name | (4S)-N-[(Z)-(3-bromophenyl)methylideneamino]-5-oxo-1,4-dihydropyrazole-4-carboxamide |
| SMILES | O=C1NN=C[C@@H]1C(=O)N/N=C\c1cccc(Br)c1 |
| InChI | InChI=1S/C11H9BrN4O2/c12-8-3-1-2-7(4-8)5-13-15-10(17)9-6-14-16-11(9)18/h1-6,9H,(H,15,17)(H,16,18)/b13-5-/t9-/m1/s1 |
| InChIKey | MGONRWISFVTKET-SRCKSBHPSA-N |
| XLogP | 0.63 |
| TPSA | 82.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.12 |
| LogP ≤ 5 | 0.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|