C25H27ClN6O3 — CID 87721687
8-chloro-10-[4-(dimethylamino)phenyl]-3-(3-morpholin-4-ylpropyl)benzo[g]pteridine-2,4-dione (PubChem CID 87721687) has the molecular formula C25H27ClN6O3 and a molecular weight of 494.98 g/mol. Its IUPAC name is 8-chloro-10-[4-(dimethylamino)phenyl]-3-(3-morpholin-4-ylpropyl)benzo[g]pteridine-2,4-dione.
| Compound Name | 8-chloro-10-[4-(dimethylamino)phenyl]-3-(3-morpholin-4-ylpropyl)benzo[g]pteridine-2,4-dione |
|---|---|
| PubChem CID | 87721687 |
| Molecular Formula | C25H27ClN6O3 |
| Molecular Weight | 494.98 g/mol |
| Exact Mass | 494.18 |
| IUPAC Name | 8-chloro-10-[4-(dimethylamino)phenyl]-3-(3-morpholin-4-ylpropyl)benzo[g]pteridine-2,4-dione |
| SMILES | CN(C)c1ccc(-n2c3nc(=O)n(CCCN4CCOCC4)c(=O)c-3nc3ccc(Cl)cc32)cc1 |
| InChI | InChI=1S/C25H27ClN6O3/c1-29(2)18-5-7-19(8-6-18)32-21-16-17(26)4-9-20(21)27-22-23(32)28-25(34)31(24(22)33)11-3-10-30-12-14-35-15-13-30/h4-9,16H,3,10-15H2,1-2H3 |
| InChIKey | KUEJILHUZKOPSA-UHFFFAOYSA-N |
| XLogP | 2.49 |
| TPSA | 85.49 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.98 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|