C23H24F4N2O3 — CID 87723468
4-[[(1S,4S)-5-[[4-(1,2,3,3-tetrafluoropropoxy)phenyl]methyl]-2,5-diazabicyclo[2.2.1]heptan-2-yl]methyl]benzoic acid (PubChem CID 87723468) has the molecular formula C23H24F4N2O3 and a molecular weight of 452.45 g/mol. Its IUPAC name is 4-[[(1S,4S)-5-[[4-(1,2,3,3-tetrafluoropropoxy)phenyl]methyl]-2,5-diazabicyclo[2.2.1]heptan-2-yl]methyl]benzoic acid.
| Compound Name | 4-[[(1S,4S)-5-[[4-(1,2,3,3-tetrafluoropropoxy)phenyl]methyl]-2,5-diazabicyclo[2.2.1]heptan-2-yl]methyl]benzoic acid |
|---|---|
| PubChem CID | 87723468 |
| Molecular Formula | C23H24F4N2O3 |
| Molecular Weight | 452.45 g/mol |
| Exact Mass | 452.17 |
| IUPAC Name | 4-[[(1S,4S)-5-[[4-(1,2,3,3-tetrafluoropropoxy)phenyl]methyl]-2,5-diazabicyclo[2.2.1]heptan-2-yl]methyl]benzoic acid |
| SMILES | O=C(O)c1ccc(CN2C[C@@H]3C[C@H]2CN3Cc2ccc(OC(F)C(F)C(F)F)cc2)cc1 |
| InChI | InChI=1S/C23H24F4N2O3/c24-20(21(25)26)22(27)32-19-7-3-15(4-8-19)11-29-13-17-9-18(29)12-28(17)10-14-1-5-16(6-2-14)23(30)31/h1-8,17-18,20-22H,9-13H2,(H,30,31)/t17-,18-,20?,22?/m0/s1 |
| InChIKey | AIOZPWOGTZPTGW-NHUPUQRLSA-N |
| XLogP | 4.12 |
| TPSA | 53.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.45 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |