C16H20N2O2 — CID 151941436
[4-[[(1S,4S)-5-ethenyl-2,5-diazabicyclo[2.2.1]heptan-2-yl]methyl]phenyl] acetate (PubChem CID 151941436) has the molecular formula C16H20N2O2 and a molecular weight of 272.35 g/mol. Its IUPAC name is [4-[[(1S,4S)-5-ethenyl-2,5-diazabicyclo[2.2.1]heptan-2-yl]methyl]phenyl] acetate.
| Compound Name | [4-[[(1S,4S)-5-ethenyl-2,5-diazabicyclo[2.2.1]heptan-2-yl]methyl]phenyl] acetate |
|---|---|
| PubChem CID | 151941436 |
| Molecular Formula | C16H20N2O2 |
| Molecular Weight | 272.35 g/mol |
| Exact Mass | 272.15 |
| IUPAC Name | [4-[[(1S,4S)-5-ethenyl-2,5-diazabicyclo[2.2.1]heptan-2-yl]methyl]phenyl] acetate |
| SMILES | C=CN1C[C@@H]2C[C@H]1CN2Cc1ccc(OC(C)=O)cc1 |
| InChI | InChI=1S/C16H20N2O2/c1-3-17-10-15-8-14(17)11-18(15)9-13-4-6-16(7-5-13)20-12(2)19/h3-7,14-15H,1,8-11H2,2H3/t14-,15-/m0/s1 |
| InChIKey | TUTKPPYTTLRKRJ-GJZGRUSLSA-N |
| XLogP | 2.01 |
| TPSA | 32.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.35 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|