C23H28N2O3 — CID 92764626
[4-[[(3R,7R,8aS)-3-benzyl-7-hydroxy-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazin-2-yl]methyl]phenyl] acetate (PubChem CID 92764626) has the molecular formula C23H28N2O3 and a molecular weight of 380.49 g/mol. Its IUPAC name is [4-[[(3R,7R,8aS)-3-benzyl-7-hydroxy-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazin-2-yl]methyl]phenyl] acetate.
| Compound Name | [4-[[(3R,7R,8aS)-3-benzyl-7-hydroxy-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazin-2-yl]methyl]phenyl] acetate |
|---|---|
| PubChem CID | 92764626 |
| Molecular Formula | C23H28N2O3 |
| Molecular Weight | 380.49 g/mol |
| Exact Mass | 380.21 |
| IUPAC Name | [4-[[(3R,7R,8aS)-3-benzyl-7-hydroxy-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazin-2-yl]methyl]phenyl] acetate |
| SMILES | CC(=O)Oc1ccc(CN2C[C@@H]3C[C@@H](O)CN3C[C@H]2Cc2ccccc2)cc1 |
| InChI | InChI=1S/C23H28N2O3/c1-17(26)28-23-9-7-19(8-10-23)13-24-15-21-12-22(27)16-25(21)14-20(24)11-18-5-3-2-4-6-18/h2-10,20-22,27H,11-16H2,1H3/t20-,21+,22-/m1/s1 |
| InChIKey | CYSJYORTRXJWKT-BHIFYINESA-N |
| XLogP | 2.47 |
| TPSA | 53.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.49 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|