C15H21N4O4S+ — CID 87731396
4-[3-[[4-(dimethylamino)phenyl]diazenyl]-1,2-oxazol-2-ium-2-yl]butane-1-sulfonic acid (PubChem CID 87731396) has the molecular formula C15H21N4O4S+ and a molecular weight of 353.42 g/mol. Its IUPAC name is 4-[3-[[4-(dimethylamino)phenyl]diazenyl]-1,2-oxazol-2-ium-2-yl]butane-1-sulfonic acid.
| Compound Name | 4-[3-[[4-(dimethylamino)phenyl]diazenyl]-1,2-oxazol-2-ium-2-yl]butane-1-sulfonic acid |
|---|---|
| PubChem CID | 87731396 |
| Molecular Formula | C15H21N4O4S+ |
| Molecular Weight | 353.42 g/mol |
| Exact Mass | 353.13 |
| IUPAC Name | 4-[3-[[4-(dimethylamino)phenyl]diazenyl]-1,2-oxazol-2-ium-2-yl]butane-1-sulfonic acid |
| SMILES | CN(C)c1ccc(/N=N/c2cco[n+]2CCCCS(=O)(=O)O)cc1 |
| InChI | InChI=1S/C15H20N4O4S/c1-18(2)14-7-5-13(6-8-14)16-17-15-9-11-23-19(15)10-3-4-12-24(20,21)22/h5-9,11H,3-4,10,12H2,1-2H3/p+1 |
| InChIKey | SIQPMXMZNDBICH-UHFFFAOYSA-O |
| XLogP | 2.72 |
| TPSA | 99.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.42 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|