C13H18N5O3S2+ — CID 87732453
3-[5-[[4-(dimethylamino)phenyl]diazenyl]-1,2,4-thiadiazol-4-ium-4-yl]propane-1-sulfonic acid (PubChem CID 87732453) has the molecular formula C13H18N5O3S2+ and a molecular weight of 356.45 g/mol. Its IUPAC name is 3-[5-[[4-(dimethylamino)phenyl]diazenyl]-1,2,4-thiadiazol-4-ium-4-yl]propane-1-sulfonic acid.
| Compound Name | 3-[5-[[4-(dimethylamino)phenyl]diazenyl]-1,2,4-thiadiazol-4-ium-4-yl]propane-1-sulfonic acid |
|---|---|
| PubChem CID | 87732453 |
| Molecular Formula | C13H18N5O3S2+ |
| Molecular Weight | 356.45 g/mol |
| Exact Mass | 356.08 |
| IUPAC Name | 3-[5-[[4-(dimethylamino)phenyl]diazenyl]-1,2,4-thiadiazol-4-ium-4-yl]propane-1-sulfonic acid |
| SMILES | CN(C)c1ccc(/N=N/c2snc[n+]2CCCS(=O)(=O)O)cc1 |
| InChI | InChI=1S/C13H17N5O3S2/c1-17(2)12-6-4-11(5-7-12)15-16-13-18(10-14-22-13)8-3-9-23(19,20)21/h4-7,10H,3,8-9H2,1-2H3/p+1 |
| InChIKey | DRABTXLJUORQJZ-UHFFFAOYSA-O |
| XLogP | 2.19 |
| TPSA | 99.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.45 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|