C32H43N3O9S — CID 87731525
6-[(5E)-5-[(2E)-2-[2-tert-butyl-7-(diethylamino)chromen-4-ylidene]ethylidene]-2,4,6-trioxo-3-(3-sulfopropyl)-1,3-diazinan-1-yl]hexanoic acid (PubChem CID 87731525) has the molecular formula C32H43N3O9S and a molecular weight of 645.78 g/mol. Its IUPAC name is 6-[(5E)-5-[(2E)-2-[2-tert-butyl-7-(diethylamino)chromen-4-ylidene]ethylidene]-2,4,6-trioxo-3-(3-sulfopropyl)-1,3-diazinan-1-yl]hexanoic acid.
| Compound Name | 6-[(5E)-5-[(2E)-2-[2-tert-butyl-7-(diethylamino)chromen-4-ylidene]ethylidene]-2,4,6-trioxo-3-(3-sulfopropyl)-1,3-diazinan-1-yl]hexanoic acid |
|---|---|
| PubChem CID | 87731525 |
| Molecular Formula | C32H43N3O9S |
| Molecular Weight | 645.78 g/mol |
| Exact Mass | 645.27 |
| IUPAC Name | 6-[(5E)-5-[(2E)-2-[2-tert-butyl-7-(diethylamino)chromen-4-ylidene]ethylidene]-2,4,6-trioxo-3-(3-sulfopropyl)-1,3-diazinan-1-yl]hexanoic acid |
| SMILES | CCN(CC)c1ccc2c(c1)OC(C(C)(C)C)=C/C2=C\C=C1/C(=O)N(CCCCCC(=O)O)C(=O)N(CCCS(=O)(=O)O)C1=O |
| InChI | InChI=1S/C32H43N3O9S/c1-6-33(7-2)23-14-16-24-22(20-27(32(3,4)5)44-26(24)21-23)13-15-25-29(38)34(17-10-8-9-12-28(36)37)31(40)35(30(25)39)18-11-19-45(41,42)43/h13-16,20-21H,6-12,17-19H2,1-5H3,(H,36,37)(H,41,42,43)/b22-13+,25-15+ |
| InChIKey | DYNYPVQAXHNYSS-GYTDJBJGSA-N |
| XLogP | 4.88 |
| TPSA | 161.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 45 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 645.78 |
| LogP ≤ 5 | 4.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'ene_six_het_A(483)', 'substructure': 'N/A'}, {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|