C32H42N3NaO9S — CID 172653060
sodium 6-[(5Z)-5-[(2Z)-2-[4-tert-butyl-7-(diethylamino)chromen-2-ylidene]ethylidene]-2,4,6-trioxo-3-(3-sulfopropyl)-1,3-diazinan-1-yl]hexanoate (PubChem CID 172653060) has the molecular formula C32H42N3NaO9S and a molecular weight of 667.76 g/mol. Its IUPAC name is sodium 6-[(5Z)-5-[(2Z)-2-[4-tert-butyl-7-(diethylamino)chromen-2-ylidene]ethylidene]-2,4,6-trioxo-3-(3-sulfopropyl)-1,3-diazinan-1-yl]hexanoate.
| Compound Name | sodium 6-[(5Z)-5-[(2Z)-2-[4-tert-butyl-7-(diethylamino)chromen-2-ylidene]ethylidene]-2,4,6-trioxo-3-(3-sulfopropyl)-1,3-diazinan-1-yl]hexanoate |
|---|---|
| PubChem CID | 172653060 |
| Molecular Formula | C32H42N3NaO9S |
| Molecular Weight | 667.76 g/mol |
| Exact Mass | 667.25 |
| IUPAC Name | sodium 6-[(5Z)-5-[(2Z)-2-[4-tert-butyl-7-(diethylamino)chromen-2-ylidene]ethylidene]-2,4,6-trioxo-3-(3-sulfopropyl)-1,3-diazinan-1-yl]hexanoate |
| SMILES | CCN(CC)c1ccc2c(c1)O/C(=C\C=C1\C(=O)N(CCCCCC(=O)[O-])C(=O)N(CCCS(=O)(=O)O)C1=O)C=C2C(C)(C)C.[Na+] |
| InChI | InChI=1S/C32H43N3O9S.Na/c1-6-33(7-2)22-13-15-24-26(32(3,4)5)21-23(44-27(24)20-22)14-16-25-29(38)34(17-10-8-9-12-28(36)37)31(40)35(30(25)39)18-11-19-45(41,42)43;/h13-16,20-21H,6-12,17-19H2,1-5H3,(H,36,37)(H,41,42,43);/q;+1/p-1/b23-14-,25-16-; |
| InChIKey | HMAWMSKJKAVASI-DNOMNNKZSA-M |
| XLogP | 0.55 |
| TPSA | 164.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 46 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 667.76 |
| LogP ≤ 5 | 0.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'ene_six_het_A(483)', 'substructure': 'N/A'}, {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|