C25H33N3O3S — CID 74061010
1-butyl-5-[7-(diethylamino)-4-propan-2-ylchromen-2-ylidene]-3-methyl-2-sulfanylidene-1,3-diazinane-4,6-dione (PubChem CID 74061010) has the molecular formula C25H33N3O3S and a molecular weight of 455.62 g/mol. Its IUPAC name is 1-butyl-5-[7-(diethylamino)-4-propan-2-ylchromen-2-ylidene]-3-methyl-2-sulfanylidene-1,3-diazinane-4,6-dione.
| Compound Name | 1-butyl-5-[7-(diethylamino)-4-propan-2-ylchromen-2-ylidene]-3-methyl-2-sulfanylidene-1,3-diazinane-4,6-dione |
|---|---|
| PubChem CID | 74061010 |
| Molecular Formula | C25H33N3O3S |
| Molecular Weight | 455.62 g/mol |
| Exact Mass | 455.22 |
| IUPAC Name | 1-butyl-5-[7-(diethylamino)-4-propan-2-ylchromen-2-ylidene]-3-methyl-2-sulfanylidene-1,3-diazinane-4,6-dione |
| SMILES | CCCCN1C(=O)C(=C2C=C(C(C)C)c3ccc(N(CC)CC)cc3O2)C(=O)N(C)C1=S |
| InChI | InChI=1S/C25H33N3O3S/c1-7-10-13-28-24(30)22(23(29)26(6)25(28)32)21-15-19(16(4)5)18-12-11-17(14-20(18)31-21)27(8-2)9-3/h11-12,14-16H,7-10,13H2,1-6H3 |
| InChIKey | JTKMJZOWZDAIOU-UHFFFAOYSA-N |
| XLogP | 4.60 |
| TPSA | 53.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.62 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|