C20H21Cl3N2O2S3 — CID 58690778
1,3-dibutyl-2-sulfanylidene-5-[5-(trichloromethyl)-1,3-benzodithiol-2-ylidene]-1,3-diazinane-4,6-dione (PubChem CID 58690778) has the molecular formula C20H21Cl3N2O2S3 and a molecular weight of 523.96 g/mol. Its IUPAC name is 1,3-dibutyl-2-sulfanylidene-5-[5-(trichloromethyl)-1,3-benzodithiol-2-ylidene]-1,3-diazinane-4,6-dione.
| Compound Name | 1,3-dibutyl-2-sulfanylidene-5-[5-(trichloromethyl)-1,3-benzodithiol-2-ylidene]-1,3-diazinane-4,6-dione |
|---|---|
| PubChem CID | 58690778 |
| Molecular Formula | C20H21Cl3N2O2S3 |
| Molecular Weight | 523.96 g/mol |
| Exact Mass | 521.98 |
| IUPAC Name | 1,3-dibutyl-2-sulfanylidene-5-[5-(trichloromethyl)-1,3-benzodithiol-2-ylidene]-1,3-diazinane-4,6-dione |
| SMILES | CCCCN1C(=O)C(=C2Sc3ccc(C(Cl)(Cl)Cl)cc3S2)C(=O)N(CCCC)C1=S |
| InChI | InChI=1S/C20H21Cl3N2O2S3/c1-3-5-9-24-16(26)15(17(27)25(19(24)28)10-6-4-2)18-29-13-8-7-12(20(21,22)23)11-14(13)30-18/h7-8,11H,3-6,9-10H2,1-2H3 |
| InChIKey | MOQWJYSAHSDULC-UHFFFAOYSA-N |
| XLogP | 6.48 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 523.96 |
| LogP ≤ 5 | 6.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|