C25H26N2O3S3 — CID 58690636
1,3-dibutyl-5-(5-phenoxy-1,3-benzodithiol-2-ylidene)-2-sulfanylidene-1,3-diazinane-4,6-dione (PubChem CID 58690636) has the molecular formula C25H26N2O3S3 and a molecular weight of 498.70 g/mol. Its IUPAC name is 1,3-dibutyl-5-(5-phenoxy-1,3-benzodithiol-2-ylidene)-2-sulfanylidene-1,3-diazinane-4,6-dione.
| Compound Name | 1,3-dibutyl-5-(5-phenoxy-1,3-benzodithiol-2-ylidene)-2-sulfanylidene-1,3-diazinane-4,6-dione |
|---|---|
| PubChem CID | 58690636 |
| Molecular Formula | C25H26N2O3S3 |
| Molecular Weight | 498.70 g/mol |
| Exact Mass | 498.11 |
| IUPAC Name | 1,3-dibutyl-5-(5-phenoxy-1,3-benzodithiol-2-ylidene)-2-sulfanylidene-1,3-diazinane-4,6-dione |
| SMILES | CCCCN1C(=O)C(=C2Sc3ccc(Oc4ccccc4)cc3S2)C(=O)N(CCCC)C1=S |
| InChI | InChI=1S/C25H26N2O3S3/c1-3-5-14-26-22(28)21(23(29)27(25(26)31)15-6-4-2)24-32-19-13-12-18(16-20(19)33-24)30-17-10-8-7-9-11-17/h7-13,16H,3-6,14-15H2,1-2H3 |
| InChIKey | KSJCWQVPDXBGFG-UHFFFAOYSA-N |
| XLogP | 6.44 |
| TPSA | 49.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.70 |
| LogP ≤ 5 | 6.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|