C17H19N3O4S3 — CID 58690684
5-[5-(dimethylamino)-1,3-benzodithiol-2-ylidene]-1,3-bis(2-hydroxyethyl)-2-sulfanylidene-1,3-diazinane-4,6-dione (PubChem CID 58690684) has the molecular formula C17H19N3O4S3 and a molecular weight of 425.56 g/mol. Its IUPAC name is 5-[5-(dimethylamino)-1,3-benzodithiol-2-ylidene]-1,3-bis(2-hydroxyethyl)-2-sulfanylidene-1,3-diazinane-4,6-dione.
| Compound Name | 5-[5-(dimethylamino)-1,3-benzodithiol-2-ylidene]-1,3-bis(2-hydroxyethyl)-2-sulfanylidene-1,3-diazinane-4,6-dione |
|---|---|
| PubChem CID | 58690684 |
| Molecular Formula | C17H19N3O4S3 |
| Molecular Weight | 425.56 g/mol |
| Exact Mass | 425.05 |
| IUPAC Name | 5-[5-(dimethylamino)-1,3-benzodithiol-2-ylidene]-1,3-bis(2-hydroxyethyl)-2-sulfanylidene-1,3-diazinane-4,6-dione |
| SMILES | CN(C)c1ccc2c(c1)SC(=C1C(=O)N(CCO)C(=S)N(CCO)C1=O)S2 |
| InChI | InChI=1S/C17H19N3O4S3/c1-18(2)10-3-4-11-12(9-10)27-16(26-11)13-14(23)19(5-7-21)17(25)20(6-8-22)15(13)24/h3-4,9,21-22H,5-8H2,1-2H3 |
| InChIKey | PPIGLUXGCVCWFR-UHFFFAOYSA-N |
| XLogP | 1.10 |
| TPSA | 84.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.56 |
| LogP ≤ 5 | 1.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|