C21H29NO2S3 — CID 58971887
5-(5-tert-butyl-1,3-benzodithiol-2-yl)-3-heptyl-2-sulfanylidene-1,3-oxazolidin-4-one (PubChem CID 58971887) has the molecular formula C21H29NO2S3 and a molecular weight of 423.67 g/mol. Its IUPAC name is 5-(5-tert-butyl-1,3-benzodithiol-2-yl)-3-heptyl-2-sulfanylidene-1,3-oxazolidin-4-one.
| Compound Name | 5-(5-tert-butyl-1,3-benzodithiol-2-yl)-3-heptyl-2-sulfanylidene-1,3-oxazolidin-4-one |
|---|---|
| PubChem CID | 58971887 |
| Molecular Formula | C21H29NO2S3 |
| Molecular Weight | 423.67 g/mol |
| Exact Mass | 423.14 |
| IUPAC Name | 5-(5-tert-butyl-1,3-benzodithiol-2-yl)-3-heptyl-2-sulfanylidene-1,3-oxazolidin-4-one |
| SMILES | CCCCCCCN1C(=O)C(C2Sc3ccc(C(C)(C)C)cc3S2)OC1=S |
| InChI | InChI=1S/C21H29NO2S3/c1-5-6-7-8-9-12-22-18(23)17(24-20(22)25)19-26-15-11-10-14(21(2,3)4)13-16(15)27-19/h10-11,13,17,19H,5-9,12H2,1-4H3 |
| InChIKey | CSNZVOCBBHYQLT-UHFFFAOYSA-N |
| XLogP | 5.99 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.67 |
| LogP ≤ 5 | 5.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|