About butoxy-oxido-oxosilane;tetramethylazanium
butoxy-oxido-oxosilane;tetramethylazanium (PubChem CID 87731634) has the molecular formula C8H21NO3Si
and a molecular weight of 207.35 g/mol. Its IUPAC name is butoxy-oxido-oxosilane;tetramethylazanium.
Molecular Properties
| Compound Name | butoxy-oxido-oxosilane;tetramethylazanium |
| PubChem CID | 87731634 |
| Molecular Formula | C8H21NO3Si |
| Molecular Weight | 207.35 g/mol |
| Exact Mass | 207.13 |
| IUPAC Name | butoxy-oxido-oxosilane;tetramethylazanium |
| SMILES | CCCCO[Si](=O)[O-].C[N+](C)(C)C |
| InChI | InChI=1S/C4H12N.C4H9O3Si/c1-5(2,3)4;1-2-3-4-7-8(5)6/h1-4H3;2-4H2,1H3/q+1;-1 |
| InChIKey | WUXGLNDWEHQJID-UHFFFAOYSA-N |
| XLogP | -0.10 |
| TPSA | 49.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 207.35 |
| LogP ≤ 5 | -0.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|
Analyze butoxy-oxido-oxosilane;tetramethylazanium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of butoxy-oxido-oxosilane;tetramethylazanium?
The IUPAC name of butoxy-oxido-oxosilane;tetramethylazanium (CID 87731634) is butoxy-oxido-oxosilane;tetramethylazanium.
What is the SMILES notation for butoxy-oxido-oxosilane;tetramethylazanium?
The canonical SMILES for butoxy-oxido-oxosilane;tetramethylazanium is CCCCO[Si](=O)[O-].C[N+](C)(C)C.
What is the InChIKey of butoxy-oxido-oxosilane;tetramethylazanium?
The InChIKey is WUXGLNDWEHQJID-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H12N.C4H9O3Si/c1-5(2,3)4;1-2-3-4-7-8(5)6/h1-4H3;2-4H2,1H3/q+1;-1.
What are the key properties of butoxy-oxido-oxosilane;tetramethylazanium?
butoxy-oxido-oxosilane;tetramethylazanium has a molecular weight of 207.35 g/mol, XLogP of -0.10, 4 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for butoxy-oxido-oxosilane;tetramethylazanium is sourced from PubChem (CID 87731634), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).