C30H27N3O4 — CID 87733424
3-[3-[2-(benzylamino)-1-[formyl(naphthalen-1-ylmethyl)amino]-2-oxoethyl]phenyl]-N-hydroxyprop-2-enamide (PubChem CID 87733424) has the molecular formula C30H27N3O4 and a molecular weight of 493.56 g/mol. Its IUPAC name is 3-[3-[2-(benzylamino)-1-[formyl(naphthalen-1-ylmethyl)amino]-2-oxoethyl]phenyl]-N-hydroxyprop-2-enamide.
| Compound Name | 3-[3-[2-(benzylamino)-1-[formyl(naphthalen-1-ylmethyl)amino]-2-oxoethyl]phenyl]-N-hydroxyprop-2-enamide |
|---|---|
| PubChem CID | 87733424 |
| Molecular Formula | C30H27N3O4 |
| Molecular Weight | 493.56 g/mol |
| Exact Mass | 493.20 |
| IUPAC Name | 3-[3-[2-(benzylamino)-1-[formyl(naphthalen-1-ylmethyl)amino]-2-oxoethyl]phenyl]-N-hydroxyprop-2-enamide |
| SMILES | O=CN(Cc1cccc2ccccc12)C(C(=O)NCc1ccccc1)c1cccc(C=CC(=O)NO)c1 |
| InChI | InChI=1S/C30H27N3O4/c34-21-33(20-26-14-7-12-24-11-4-5-15-27(24)26)29(30(36)31-19-23-8-2-1-3-9-23)25-13-6-10-22(18-25)16-17-28(35)32-37/h1-18,21,29,37H,19-20H2,(H,31,36)(H,32,35) |
| InChIKey | DLIQOCXQTRFASD-UHFFFAOYSA-N |
| XLogP | 4.37 |
| TPSA | 98.74 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 37 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.56 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|