C31H27N3O4 — CID 87733584
N-[2-(benzylamino)-1-[3-[(E)-3-(hydroxyamino)-3-oxoprop-1-enyl]phenyl]-2-oxoethyl]-4-phenylbenzamide (PubChem CID 87733584) has the molecular formula C31H27N3O4 and a molecular weight of 505.57 g/mol. Its IUPAC name is N-[2-(benzylamino)-1-[3-[(E)-3-(hydroxyamino)-3-oxoprop-1-enyl]phenyl]-2-oxoethyl]-4-phenylbenzamide.
| Compound Name | N-[2-(benzylamino)-1-[3-[(E)-3-(hydroxyamino)-3-oxoprop-1-enyl]phenyl]-2-oxoethyl]-4-phenylbenzamide |
|---|---|
| PubChem CID | 87733584 |
| Molecular Formula | C31H27N3O4 |
| Molecular Weight | 505.57 g/mol |
| Exact Mass | 505.20 |
| IUPAC Name | N-[2-(benzylamino)-1-[3-[(E)-3-(hydroxyamino)-3-oxoprop-1-enyl]phenyl]-2-oxoethyl]-4-phenylbenzamide |
| SMILES | O=C(/C=C/c1cccc(C(NC(=O)c2ccc(-c3ccccc3)cc2)C(=O)NCc2ccccc2)c1)NO |
| InChI | InChI=1S/C31H27N3O4/c35-28(34-38)19-14-22-10-7-13-27(20-22)29(31(37)32-21-23-8-3-1-4-9-23)33-30(36)26-17-15-25(16-18-26)24-11-5-2-6-12-24/h1-20,29,38H,21H2,(H,32,37)(H,33,36)(H,34,35)/b19-14+ |
| InChIKey | FLSMOTVGBDNZEH-XMHGGMMESA-N |
| XLogP | 4.66 |
| TPSA | 107.53 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 505.57 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|