C32H38N2O5 — CID 87733526
hexanal;N-[5-(hydroxymethyl)-2-phenylmethoxyphenyl]-2-(5-methoxy-2-methyl-1H-indol-3-yl)acetamide (PubChem CID 87733526) has the molecular formula C32H38N2O5 and a molecular weight of 530.67 g/mol. Its IUPAC name is hexanal;N-[5-(hydroxymethyl)-2-phenylmethoxyphenyl]-2-(5-methoxy-2-methyl-1H-indol-3-yl)acetamide.
| Compound Name | hexanal;N-[5-(hydroxymethyl)-2-phenylmethoxyphenyl]-2-(5-methoxy-2-methyl-1H-indol-3-yl)acetamide |
|---|---|
| PubChem CID | 87733526 |
| Molecular Formula | C32H38N2O5 |
| Molecular Weight | 530.67 g/mol |
| Exact Mass | 530.28 |
| IUPAC Name | hexanal;N-[5-(hydroxymethyl)-2-phenylmethoxyphenyl]-2-(5-methoxy-2-methyl-1H-indol-3-yl)acetamide |
| SMILES | CCCCCC=O.COc1ccc2[nH]c(C)c(CC(=O)Nc3cc(CO)ccc3OCc3ccccc3)c2c1 |
| InChI | InChI=1S/C26H26N2O4.C6H12O/c1-17-21(22-13-20(31-2)9-10-23(22)27-17)14-26(30)28-24-12-19(15-29)8-11-25(24)32-16-18-6-4-3-5-7-18;1-2-3-4-5-6-7/h3-13,27,29H,14-16H2,1-2H3,(H,28,30);6H,2-5H2,1H3 |
| InChIKey | MURQCBBWWXGTPI-UHFFFAOYSA-N |
| XLogP | 6.50 |
| TPSA | 100.65 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 530.67 |
| LogP ≤ 5 | 6.50 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|