About heptan-3-ylphosphane;yttrium
heptan-3-ylphosphane;yttrium (PubChem CID 87745018) has the molecular formula C7H17PY
and a molecular weight of 221.09 g/mol. Its IUPAC name is heptan-3-ylphosphane;yttrium.
Molecular Properties
| Compound Name | heptan-3-ylphosphane;yttrium |
| PubChem CID | 87745018 |
| Molecular Formula | C7H17PY |
| Molecular Weight | 221.09 g/mol |
| Exact Mass | 221.01 |
| IUPAC Name | heptan-3-ylphosphane;yttrium |
| SMILES | CCCCC(P)CC.[Y] |
| InChI | InChI=1S/C7H17P.Y/c1-3-5-6-7(8)4-2;/h7H,3-6,8H2,1-2H3; |
| InChIKey | TZQYBACJXJGODU-UHFFFAOYSA-N |
| XLogP | 2.83 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 221.09 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze heptan-3-ylphosphane;yttrium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of heptan-3-ylphosphane;yttrium?
The IUPAC name of heptan-3-ylphosphane;yttrium (CID 87745018) is heptan-3-ylphosphane;yttrium.
What is the SMILES notation for heptan-3-ylphosphane;yttrium?
The canonical SMILES for heptan-3-ylphosphane;yttrium is CCCCC(P)CC.[Y].
What is the InChIKey of heptan-3-ylphosphane;yttrium?
The InChIKey is TZQYBACJXJGODU-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H17P.Y/c1-3-5-6-7(8)4-2;/h7H,3-6,8H2,1-2H3;.
What are the key properties of heptan-3-ylphosphane;yttrium?
heptan-3-ylphosphane;yttrium has a molecular weight of 221.09 g/mol, XLogP of 2.83, 4 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for heptan-3-ylphosphane;yttrium is sourced from PubChem (CID 87745018), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).