C31H62O4 — CID 87746966
(Z)-6-(6-hydroxyhexyl)-5-methyltetracos-15-ene-1,5,24-triol (PubChem CID 87746966) has the molecular formula C31H62O4 and a molecular weight of 498.83 g/mol. Its IUPAC name is (Z)-6-(6-hydroxyhexyl)-5-methyltetracos-15-ene-1,5,24-triol.
| Compound Name | (Z)-6-(6-hydroxyhexyl)-5-methyltetracos-15-ene-1,5,24-triol |
|---|---|
| PubChem CID | 87746966 |
| Molecular Formula | C31H62O4 |
| Molecular Weight | 498.83 g/mol |
| Exact Mass | 498.46 |
| IUPAC Name | (Z)-6-(6-hydroxyhexyl)-5-methyltetracos-15-ene-1,5,24-triol |
| SMILES | CC(O)(CCCCO)C(CCCCCCO)CCCCCCCC/C=C\CCCCCCCCO |
| InChI | InChI=1S/C31H62O4/c1-31(35,26-20-23-29-34)30(25-19-15-17-22-28-33)24-18-14-12-10-8-6-4-2-3-5-7-9-11-13-16-21-27-32/h2-3,30,32-35H,4-29H2,1H3/b3-2- |
| InChIKey | VESWKKAIATUAMO-IHWYPQMZSA-N |
| XLogP | 7.86 |
| TPSA | 80.92 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 28 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.83 |
| LogP ≤ 5 | 7.86 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|