C18H28N2O5S — CID 87749307
2,5-dihydroxybenzenesulfonate;5-methyl-3-octyl-1H-imidazol-3-ium (PubChem CID 87749307) has the molecular formula C18H28N2O5S and a molecular weight of 384.50 g/mol. Its IUPAC name is 2,5-dihydroxybenzenesulfonate;5-methyl-3-octyl-1H-imidazol-3-ium.
| Compound Name | 2,5-dihydroxybenzenesulfonate;5-methyl-3-octyl-1H-imidazol-3-ium |
|---|---|
| PubChem CID | 87749307 |
| Molecular Formula | C18H28N2O5S |
| Molecular Weight | 384.50 g/mol |
| Exact Mass | 384.17 |
| IUPAC Name | 2,5-dihydroxybenzenesulfonate;5-methyl-3-octyl-1H-imidazol-3-ium |
| SMILES | CCCCCCCC[n+]1c[nH]c(C)c1.O=S(=O)([O-])c1cc(O)ccc1O |
| InChI | InChI=1S/C12H22N2.C6H6O5S/c1-3-4-5-6-7-8-9-14-10-12(2)13-11-14;7-4-1-2-5(8)6(3-4)12(9,10)11/h10-11H,3-9H2,1-2H3;1-3,7-8H,(H,9,10,11) |
| InChIKey | VPJCMRWSWHFILR-UHFFFAOYSA-N |
| XLogP | 2.97 |
| TPSA | 117.33 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.50 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|