C18H24O12 — CID 87749491
[3-[(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-[[(2S,3R,4S,5R)-3,4,5-trihydroxyoxan-2-yl]oxymethyl]oxan-2-yl]oxyphenyl] formate (PubChem CID 87749491) has the molecular formula C18H24O12 and a molecular weight of 432.38 g/mol. Its IUPAC name is [3-[(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-[[(2S,3R,4S,5R)-3,4,5-trihydroxyoxan-2-yl]oxymethyl]oxan-2-yl]oxyphenyl] formate.
| Compound Name | [3-[(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-[[(2S,3R,4S,5R)-3,4,5-trihydroxyoxan-2-yl]oxymethyl]oxan-2-yl]oxyphenyl] formate |
|---|---|
| PubChem CID | 87749491 |
| Molecular Formula | C18H24O12 |
| Molecular Weight | 432.38 g/mol |
| Exact Mass | 432.13 |
| IUPAC Name | [3-[(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-[[(2S,3R,4S,5R)-3,4,5-trihydroxyoxan-2-yl]oxymethyl]oxan-2-yl]oxyphenyl] formate |
| SMILES | O=COc1cccc(O[C@@H]2O[C@H](CO[C@@H]3OC[C@@H](O)[C@H](O)[C@H]3O)[C@@H](O)[C@H](O)[C@H]2O)c1 |
| InChI | InChI=1S/C18H24O12/c19-7-28-8-2-1-3-9(4-8)29-18-16(25)14(23)13(22)11(30-18)6-27-17-15(24)12(21)10(20)5-26-17/h1-4,7,10-18,20-25H,5-6H2/t10-,11-,12+,13-,14+,15-,16-,17+,18-/m1/s1 |
| InChIKey | VBNBKZBTKREPLR-NWQIESHVSA-N |
| XLogP | -3.14 |
| TPSA | 184.60 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.38 |
| LogP ≤ 5 | -3.14 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|