C26H27BrN2O2 — CID 87751316
2-(4-aza-1-azoniabicyclo[2.2.2]octan-1-yl)-4-naphthalen-1-yl-1-phenylbutane-1,4-dione bromide (PubChem CID 87751316) has the molecular formula C26H27BrN2O2 and a molecular weight of 479.42 g/mol. Its IUPAC name is 2-(4-aza-1-azoniabicyclo[2.2.2]octan-1-yl)-4-naphthalen-1-yl-1-phenylbutane-1,4-dione bromide.
| Compound Name | 2-(4-aza-1-azoniabicyclo[2.2.2]octan-1-yl)-4-naphthalen-1-yl-1-phenylbutane-1,4-dione bromide |
|---|---|
| PubChem CID | 87751316 |
| Molecular Formula | C26H27BrN2O2 |
| Molecular Weight | 479.42 g/mol |
| Exact Mass | 478.13 |
| IUPAC Name | 2-(4-aza-1-azoniabicyclo[2.2.2]octan-1-yl)-4-naphthalen-1-yl-1-phenylbutane-1,4-dione bromide |
| SMILES | O=C(CC(C(=O)c1ccccc1)[N+]12CCN(CC1)CC2)c1cccc2ccccc12.[Br-] |
| InChI | InChI=1S/C26H27N2O2.BrH/c29-25(23-12-6-10-20-7-4-5-11-22(20)23)19-24(26(30)21-8-2-1-3-9-21)28-16-13-27(14-17-28)15-18-28;/h1-12,24H,13-19H2;1H/q+1;/p-1 |
| InChIKey | OPBQRAPMCMQFRF-UHFFFAOYSA-M |
| XLogP | 0.81 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.42 |
| LogP ≤ 5 | 0.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|