About cyanamide;methoxymethyl(pentan-3-yl)phosphane
cyanamide;methoxymethyl(pentan-3-yl)phosphane (PubChem CID 87751625) has the molecular formula C9H21N4OP
and a molecular weight of 232.27 g/mol. Its IUPAC name is cyanamide;methoxymethyl(pentan-3-yl)phosphane.
Molecular Properties
| Compound Name | cyanamide;methoxymethyl(pentan-3-yl)phosphane |
| PubChem CID | 87751625 |
| Molecular Formula | C9H21N4OP |
| Molecular Weight | 232.27 g/mol |
| Exact Mass | 232.15 |
| IUPAC Name | cyanamide;methoxymethyl(pentan-3-yl)phosphane |
| SMILES | CCC(CC)PCOC.N#CN.N#CN |
| InChI | InChI=1S/C7H17OP.2CH2N2/c1-4-7(5-2)9-6-8-3;2*2-1-3/h7,9H,4-6H2,1-3H3;2*2H2 |
| InChIKey | UGNDQNSDWFXYEE-UHFFFAOYSA-N |
| XLogP | 1.31 |
| TPSA | 108.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 232.27 |
| LogP ≤ 5 | 1.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'enamine', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze cyanamide;methoxymethyl(pentan-3-yl)phosphane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of cyanamide;methoxymethyl(pentan-3-yl)phosphane?
The IUPAC name of cyanamide;methoxymethyl(pentan-3-yl)phosphane (CID 87751625) is cyanamide;methoxymethyl(pentan-3-yl)phosphane.
What is the SMILES notation for cyanamide;methoxymethyl(pentan-3-yl)phosphane?
The canonical SMILES for cyanamide;methoxymethyl(pentan-3-yl)phosphane is CCC(CC)PCOC.N#CN.N#CN.
What is the InChIKey of cyanamide;methoxymethyl(pentan-3-yl)phosphane?
The InChIKey is UGNDQNSDWFXYEE-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H17OP.2CH2N2/c1-4-7(5-2)9-6-8-3;2*2-1-3/h7,9H,4-6H2,1-3H3;2*2H2.
What are the key properties of cyanamide;methoxymethyl(pentan-3-yl)phosphane?
cyanamide;methoxymethyl(pentan-3-yl)phosphane has a molecular weight of 232.27 g/mol, XLogP of 1.31, 5 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for cyanamide;methoxymethyl(pentan-3-yl)phosphane is sourced from PubChem (CID 87751625), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).