C17H19N3O3S2 — CID 87751897
[2-[[5-(sulfanylmethyl)-1,3-thiazol-2-yl]carbamoyl]phenyl] piperidine-4-carboxylate (PubChem CID 87751897) has the molecular formula C17H19N3O3S2 and a molecular weight of 377.49 g/mol. Its IUPAC name is [2-[[5-(sulfanylmethyl)-1,3-thiazol-2-yl]carbamoyl]phenyl] piperidine-4-carboxylate.
| Compound Name | [2-[[5-(sulfanylmethyl)-1,3-thiazol-2-yl]carbamoyl]phenyl] piperidine-4-carboxylate |
|---|---|
| PubChem CID | 87751897 |
| Molecular Formula | C17H19N3O3S2 |
| Molecular Weight | 377.49 g/mol |
| Exact Mass | 377.09 |
| IUPAC Name | [2-[[5-(sulfanylmethyl)-1,3-thiazol-2-yl]carbamoyl]phenyl] piperidine-4-carboxylate |
| SMILES | O=C(Nc1ncc(CS)s1)c1ccccc1OC(=O)C1CCNCC1 |
| InChI | InChI=1S/C17H19N3O3S2/c21-15(20-17-19-9-12(10-24)25-17)13-3-1-2-4-14(13)23-16(22)11-5-7-18-8-6-11/h1-4,9,11,18,24H,5-8,10H2,(H,19,20,21) |
| InChIKey | OLTWUWDBXOMGLZ-UHFFFAOYSA-N |
| XLogP | 2.73 |
| TPSA | 80.32 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.49 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|