C17H24N6O3 — CID 87755959
(3R)-N-hydroxy-3-[[(5-methyl-1,2,4-benzotriazin-3-yl)amino]carbamoyl]octanamide (PubChem CID 87755959) has the molecular formula C17H24N6O3 and a molecular weight of 360.42 g/mol. Its IUPAC name is (3R)-N-hydroxy-3-[[(5-methyl-1,2,4-benzotriazin-3-yl)amino]carbamoyl]octanamide.
| Compound Name | (3R)-N-hydroxy-3-[[(5-methyl-1,2,4-benzotriazin-3-yl)amino]carbamoyl]octanamide |
|---|---|
| PubChem CID | 87755959 |
| Molecular Formula | C17H24N6O3 |
| Molecular Weight | 360.42 g/mol |
| Exact Mass | 360.19 |
| IUPAC Name | (3R)-N-hydroxy-3-[[(5-methyl-1,2,4-benzotriazin-3-yl)amino]carbamoyl]octanamide |
| SMILES | CCCCC[C@H](CC(=O)NO)C(=O)NNc1nnc2cccc(C)c2n1 |
| InChI | InChI=1S/C17H24N6O3/c1-3-4-5-8-12(10-14(24)23-26)16(25)20-22-17-18-15-11(2)7-6-9-13(15)19-21-17/h6-7,9,12,26H,3-5,8,10H2,1-2H3,(H,20,25)(H,23,24)(H,18,21,22)/t12-/m1/s1 |
| InChIKey | NEKVLCURNACGKM-GFCCVEGCSA-N |
| XLogP | 1.87 |
| TPSA | 129.13 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.42 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|