C28H24F8N2O — CID 87757127
1-cyclopentyl-3-[2-[3-fluoro-5-(trifluoromethyl)phenyl]-2-[4-fluoro-3-(trifluoromethyl)phenyl]-2-phenylethyl]urea (PubChem CID 87757127) has the molecular formula C28H24F8N2O and a molecular weight of 556.50 g/mol. Its IUPAC name is 1-cyclopentyl-3-[2-[3-fluoro-5-(trifluoromethyl)phenyl]-2-[4-fluoro-3-(trifluoromethyl)phenyl]-2-phenylethyl]urea.
| Compound Name | 1-cyclopentyl-3-[2-[3-fluoro-5-(trifluoromethyl)phenyl]-2-[4-fluoro-3-(trifluoromethyl)phenyl]-2-phenylethyl]urea |
|---|---|
| PubChem CID | 87757127 |
| Molecular Formula | C28H24F8N2O |
| Molecular Weight | 556.50 g/mol |
| Exact Mass | 556.18 |
| IUPAC Name | 1-cyclopentyl-3-[2-[3-fluoro-5-(trifluoromethyl)phenyl]-2-[4-fluoro-3-(trifluoromethyl)phenyl]-2-phenylethyl]urea |
| SMILES | O=C(NCC(c1ccccc1)(c1cc(F)cc(C(F)(F)F)c1)c1ccc(F)c(C(F)(F)F)c1)NC1CCCC1 |
| InChI | InChI=1S/C28H24F8N2O/c29-21-13-19(12-20(14-21)27(31,32)33)26(17-6-2-1-3-7-17,16-37-25(39)38-22-8-4-5-9-22)18-10-11-24(30)23(15-18)28(34,35)36/h1-3,6-7,10-15,22H,4-5,8-9,16H2,(H2,37,38,39) |
| InChIKey | BXNCEIGDLXGBGV-UHFFFAOYSA-N |
| XLogP | 7.58 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 556.50 |
| LogP ≤ 5 | 7.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|