C18H18N4O — CID 87761682
4-[3-[(E)-N-methoxy-C-methylcarbonimidoyl]phenyl]-2,6-dimethyl-1,4-dihydropyridine-3,5-dicarbonitrile (PubChem CID 87761682) has the molecular formula C18H18N4O and a molecular weight of 306.37 g/mol. Its IUPAC name is 4-[3-[(E)-N-methoxy-C-methylcarbonimidoyl]phenyl]-2,6-dimethyl-1,4-dihydropyridine-3,5-dicarbonitrile.
| Compound Name | 4-[3-[(E)-N-methoxy-C-methylcarbonimidoyl]phenyl]-2,6-dimethyl-1,4-dihydropyridine-3,5-dicarbonitrile |
|---|---|
| PubChem CID | 87761682 |
| Molecular Formula | C18H18N4O |
| Molecular Weight | 306.37 g/mol |
| Exact Mass | 306.15 |
| IUPAC Name | 4-[3-[(E)-N-methoxy-C-methylcarbonimidoyl]phenyl]-2,6-dimethyl-1,4-dihydropyridine-3,5-dicarbonitrile |
| SMILES | CO/N=C(\C)c1cccc(C2C(C#N)=C(C)NC(C)=C2C#N)c1 |
| InChI | InChI=1S/C18H18N4O/c1-11(22-23-4)14-6-5-7-15(8-14)18-16(9-19)12(2)21-13(3)17(18)10-20/h5-8,18,21H,1-4H3/b22-11+ |
| InChIKey | MVFSZPXZNKSDNF-SSDVNMTOSA-N |
| XLogP | 3.34 |
| TPSA | 81.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.37 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|