C13H16N2O5S — CID 87763669
2,4-dimethyl-1,3-oxazole-5-carboxamide;4-methylbenzenesulfonic acid (PubChem CID 87763669) has the molecular formula C13H16N2O5S and a molecular weight of 312.35 g/mol. Its IUPAC name is 2,4-dimethyl-1,3-oxazole-5-carboxamide;4-methylbenzenesulfonic acid.
| Compound Name | 2,4-dimethyl-1,3-oxazole-5-carboxamide;4-methylbenzenesulfonic acid |
|---|---|
| PubChem CID | 87763669 |
| Molecular Formula | C13H16N2O5S |
| Molecular Weight | 312.35 g/mol |
| Exact Mass | 312.08 |
| IUPAC Name | 2,4-dimethyl-1,3-oxazole-5-carboxamide;4-methylbenzenesulfonic acid |
| SMILES | Cc1ccc(S(=O)(=O)O)cc1.Cc1nc(C)c(C(N)=O)o1 |
| InChI | InChI=1S/C7H8O3S.C6H8N2O2/c1-6-2-4-7(5-3-6)11(8,9)10;1-3-5(6(7)9)10-4(2)8-3/h2-5H,1H3,(H,8,9,10);1-2H3,(H2,7,9) |
| InChIKey | INPLSROPECDJNH-UHFFFAOYSA-N |
| XLogP | 1.63 |
| TPSA | 123.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.35 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|