About bis(trifluoromethylsulfonyl)azanide;trioctylazanium
bis(trifluoromethylsulfonyl)azanide;trioctylazanium (PubChem CID 87764843) has the molecular formula C26H52F6N2O4S2
and a molecular weight of 634.83 g/mol. Its IUPAC name is bis(trifluoromethylsulfonyl)azanide;trioctylazanium.
Molecular Properties
| Compound Name | bis(trifluoromethylsulfonyl)azanide;trioctylazanium |
| PubChem CID | 87764843 |
| Molecular Formula | C26H52F6N2O4S2 |
| Molecular Weight | 634.83 g/mol |
| Exact Mass | 634.33 |
| IUPAC Name | bis(trifluoromethylsulfonyl)azanide;trioctylazanium |
| SMILES | CCCCCCCC[NH+](CCCCCCCC)CCCCCCCC.O=S(=O)([N-]S(=O)(=O)C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C24H51N.C2F6NO4S2/c1-4-7-10-13-16-19-22-25(23-20-17-14-11-8-5-2)24-21-18-15-12-9-6-3;3-1(4,5)14(10,11)9-15(12,13)2(6,7)8/h4-24H2,1-3H3;/q;-1/p+1 |
| InChIKey | DVBWFZGRBLDHFU-UHFFFAOYSA-O |
| XLogP | 8.01 |
| TPSA | 86.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 23 |
| Heavy Atoms | 40 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 634.83 |
| LogP ≤ 5 | 8.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze bis(trifluoromethylsulfonyl)azanide;trioctylazanium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of bis(trifluoromethylsulfonyl)azanide;trioctylazanium?
The IUPAC name of bis(trifluoromethylsulfonyl)azanide;trioctylazanium (CID 87764843) is bis(trifluoromethylsulfonyl)azanide;trioctylazanium.
What is the SMILES notation for bis(trifluoromethylsulfonyl)azanide;trioctylazanium?
The canonical SMILES for bis(trifluoromethylsulfonyl)azanide;trioctylazanium is CCCCCCCC[NH+](CCCCCCCC)CCCCCCCC.O=S(=O)([N-]S(=O)(=O)C(F)(F)F)C(F)(F)F.
What is the InChIKey of bis(trifluoromethylsulfonyl)azanide;trioctylazanium?
The InChIKey is DVBWFZGRBLDHFU-UHFFFAOYSA-O. The full InChI is InChI=1S/C24H51N.C2F6NO4S2/c1-4-7-10-13-16-19-22-25(23-20-17-14-11-8-5-2)24-21-18-15-12-9-6-3;3-1(4,5)14(10,11)9-15(12,13)2(6,7)8/h4-24H2,1-3H3;/q;-1/p+1.
What are the key properties of bis(trifluoromethylsulfonyl)azanide;trioctylazanium?
bis(trifluoromethylsulfonyl)azanide;trioctylazanium has a molecular weight of 634.83 g/mol, XLogP of 8.01, 23 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for bis(trifluoromethylsulfonyl)azanide;trioctylazanium is sourced from PubChem (CID 87764843), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).