C16H20O6S — CID 87766622
trans-benzyl (1S,2R)-2-(methylsulfonyloxymethyl)-4-oxocyclohexane-1-carboxylate (PubChem CID 87766622) has the molecular formula C16H20O6S and a molecular weight of 340.40 g/mol. Its IUPAC name is trans-benzyl (1S,2R)-2-(methylsulfonyloxymethyl)-4-oxocyclohexane-1-carboxylate.
| Compound Name | trans-benzyl (1S,2R)-2-(methylsulfonyloxymethyl)-4-oxocyclohexane-1-carboxylate |
|---|---|
| PubChem CID | 87766622 |
| Molecular Formula | C16H20O6S |
| Molecular Weight | 340.40 g/mol |
| Exact Mass | 340.10 |
| IUPAC Name | trans-benzyl (1S,2R)-2-(methylsulfonyloxymethyl)-4-oxocyclohexane-1-carboxylate |
| SMILES | CS(=O)(=O)OC[C@@H]1CC(=O)CC[C@@H]1C(=O)OCc1ccccc1 |
| InChI | InChI=1S/C16H20O6S/c1-23(19,20)22-11-13-9-14(17)7-8-15(13)16(18)21-10-12-5-3-2-4-6-12/h2-6,13,15H,7-11H2,1H3/t13-,15-/m0/s1 |
| InChIKey | HKWISMUGFVMHFU-ZFWWWQNUSA-N |
| XLogP | 1.69 |
| TPSA | 86.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.40 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|