C15H18F3N3O5 — CID 87769883
[[3-(2-aminoethylamino)-3-oxopropyl]-phenylmethoxycarbonylamino] 2,2,2-trifluoroacetate (PubChem CID 87769883) has the molecular formula C15H18F3N3O5 and a molecular weight of 377.32 g/mol. Its IUPAC name is [[3-(2-aminoethylamino)-3-oxopropyl]-phenylmethoxycarbonylamino] 2,2,2-trifluoroacetate.
| Compound Name | [[3-(2-aminoethylamino)-3-oxopropyl]-phenylmethoxycarbonylamino] 2,2,2-trifluoroacetate |
|---|---|
| PubChem CID | 87769883 |
| Molecular Formula | C15H18F3N3O5 |
| Molecular Weight | 377.32 g/mol |
| Exact Mass | 377.12 |
| IUPAC Name | [[3-(2-aminoethylamino)-3-oxopropyl]-phenylmethoxycarbonylamino] 2,2,2-trifluoroacetate |
| SMILES | NCCNC(=O)CCN(OC(=O)C(F)(F)F)C(=O)OCc1ccccc1 |
| InChI | InChI=1S/C15H18F3N3O5/c16-15(17,18)13(23)26-21(9-6-12(22)20-8-7-19)14(24)25-10-11-4-2-1-3-5-11/h1-5H,6-10,19H2,(H,20,22) |
| InChIKey | MFMDPXMXWNCIPW-UHFFFAOYSA-N |
| XLogP | 1.11 |
| TPSA | 110.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.32 |
| LogP ≤ 5 | 1.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|