C8H12NNaO7P2 — CID 87770234
sodium [2-(2-amino-4-phosphonophenyl)-1-hydroxyethyl]-hydroxyphosphinate (PubChem CID 87770234) has the molecular formula C8H12NNaO7P2 and a molecular weight of 319.12 g/mol. Its IUPAC name is sodium [2-(2-amino-4-phosphonophenyl)-1-hydroxyethyl]-hydroxyphosphinate.
| Compound Name | sodium [2-(2-amino-4-phosphonophenyl)-1-hydroxyethyl]-hydroxyphosphinate |
|---|---|
| PubChem CID | 87770234 |
| Molecular Formula | C8H12NNaO7P2 |
| Molecular Weight | 319.12 g/mol |
| Exact Mass | 319.00 |
| IUPAC Name | sodium [2-(2-amino-4-phosphonophenyl)-1-hydroxyethyl]-hydroxyphosphinate |
| SMILES | Nc1cc(P(=O)(O)O)ccc1CC(O)P(=O)([O-])O.[Na+] |
| InChI | InChI=1S/C8H13NO7P2.Na/c9-7-4-6(17(11,12)13)2-1-5(7)3-8(10)18(14,15)16;/h1-2,4,8,10H,3,9H2,(H2,11,12,13)(H2,14,15,16);/q;+1/p-1 |
| InChIKey | HLOFJEBBICYDLR-UHFFFAOYSA-M |
| XLogP | -4.52 |
| TPSA | 164.14 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.12 |
| LogP ≤ 5 | -4.52 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|