C28H36N2O7S — CID 87772607
2-[(4R,7aR,12bS)-4a,9-dihydroxy-3-prop-2-enyl-1,2,4,5,6,7,7a,13-octahydro-4,12-methanobenzofuro[3,2-e]isoquinolin-7-yl]-4,5,6,7-tetrahydro-3H-isoindol-1-one;methanesulfonic acid (PubChem CID 87772607) has the molecular formula C28H36N2O7S and a molecular weight of 544.67 g/mol. Its IUPAC name is 2-[(4R,7aR,12bS)-4a,9-dihydroxy-3-prop-2-enyl-1,2,4,5,6,7,7a,13-octahydro-4,12-methanobenzofuro[3,2-e]isoquinolin-7-yl]-4,5,6,7-tetrahydro-3H-isoindol-1-one;methanesulfonic acid.
| Compound Name | 2-[(4R,7aR,12bS)-4a,9-dihydroxy-3-prop-2-enyl-1,2,4,5,6,7,7a,13-octahydro-4,12-methanobenzofuro[3,2-e]isoquinolin-7-yl]-4,5,6,7-tetrahydro-3H-isoindol-1-one;methanesulfonic acid |
|---|---|
| PubChem CID | 87772607 |
| Molecular Formula | C28H36N2O7S |
| Molecular Weight | 544.67 g/mol |
| Exact Mass | 544.22 |
| IUPAC Name | 2-[(4R,7aR,12bS)-4a,9-dihydroxy-3-prop-2-enyl-1,2,4,5,6,7,7a,13-octahydro-4,12-methanobenzofuro[3,2-e]isoquinolin-7-yl]-4,5,6,7-tetrahydro-3H-isoindol-1-one;methanesulfonic acid |
| SMILES | C=CCN1CC[C@]23c4c5ccc(O)c4O[C@H]2C(N2CC4=C(CCCC4)C2=O)CCC3(O)[C@H]1C5.CS(=O)(=O)O |
| InChI | InChI=1S/C27H32N2O4.CH4O3S/c1-2-12-28-13-11-26-22-16-7-8-20(30)23(22)33-24(26)19(9-10-27(26,32)21(28)14-16)29-15-17-5-3-4-6-18(17)25(29)31;1-5(2,3)4/h2,7-8,19,21,24,30,32H,1,3-6,9-15H2;1H3,(H,2,3,4)/t19?,21-,24+,26+,27?;/m1./s1 |
| InChIKey | GVGJNPMUHNKGLV-DBFUQLCDSA-N |
| XLogP | 2.32 |
| TPSA | 127.61 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 544.67 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|