C27H32N2O4 — CID 91246683
(4R,4aS,7S,7aR,12bS)-7-(1-hydroxy-4,5,6,7-tetrahydroisoindol-2-yl)-3-prop-2-enyl-1,2,4,5,6,7,7a,13-octahydro-4,12-methanobenzofuro[3,2-e]isoquinoline-4a,9-diol (PubChem CID 91246683) has the molecular formula C27H32N2O4 and a molecular weight of 448.56 g/mol. Its IUPAC name is (4R,4aS,7S,7aR,12bS)-7-(1-hydroxy-4,5,6,7-tetrahydroisoindol-2-yl)-3-prop-2-enyl-1,2,4,5,6,7,7a,13-octahydro-4,12-methanobenzofuro[3,2-e]isoquinoline-4a,9-diol.
| Compound Name | (4R,4aS,7S,7aR,12bS)-7-(1-hydroxy-4,5,6,7-tetrahydroisoindol-2-yl)-3-prop-2-enyl-1,2,4,5,6,7,7a,13-octahydro-4,12-methanobenzofuro[3,2-e]isoquinoline-4a,9-diol |
|---|---|
| PubChem CID | 91246683 |
| Molecular Formula | C27H32N2O4 |
| Molecular Weight | 448.56 g/mol |
| Exact Mass | 448.24 |
| IUPAC Name | (4R,4aS,7S,7aR,12bS)-7-(1-hydroxy-4,5,6,7-tetrahydroisoindol-2-yl)-3-prop-2-enyl-1,2,4,5,6,7,7a,13-octahydro-4,12-methanobenzofuro[3,2-e]isoquinoline-4a,9-diol |
| SMILES | C=CCN1CC[C@]23c4c5ccc(O)c4O[C@H]2[C@@H](n2cc4c(c2O)CCCC4)CC[C@@]3(O)[C@H]1C5 |
| InChI | InChI=1S/C27H32N2O4/c1-2-12-28-13-11-26-22-16-7-8-20(30)23(22)33-24(26)19(9-10-27(26,32)21(28)14-16)29-15-17-5-3-4-6-18(17)25(29)31/h2,7-8,15,19,21,24,30-32H,1,3-6,9-14H2/t19-,21+,24-,26-,27+/m0/s1 |
| InChIKey | HYHQNXWSMZRXAL-ZENJXJHVSA-N |
| XLogP | 3.36 |
| TPSA | 78.09 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.56 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|