C26H26N2O6S — CID 58603865
2-[(4S,4aS,7R,7aR,12bS)-4a,9-dihydroxy-3-prop-2-enyl-1,2,4,5,6,7,7a,13-octahydro-4,12-methanobenzofuro[3,2-e]isoquinolin-7-yl]-1,1-dioxo-1,2-benzothiazol-3-one (PubChem CID 58603865) has the molecular formula C26H26N2O6S and a molecular weight of 494.57 g/mol. Its IUPAC name is 2-[(4S,4aS,7R,7aR,12bS)-4a,9-dihydroxy-3-prop-2-enyl-1,2,4,5,6,7,7a,13-octahydro-4,12-methanobenzofuro[3,2-e]isoquinolin-7-yl]-1,1-dioxo-1,2-benzothiazol-3-one.
| Compound Name | 2-[(4S,4aS,7R,7aR,12bS)-4a,9-dihydroxy-3-prop-2-enyl-1,2,4,5,6,7,7a,13-octahydro-4,12-methanobenzofuro[3,2-e]isoquinolin-7-yl]-1,1-dioxo-1,2-benzothiazol-3-one |
|---|---|
| PubChem CID | 58603865 |
| Molecular Formula | C26H26N2O6S |
| Molecular Weight | 494.57 g/mol |
| Exact Mass | 494.15 |
| IUPAC Name | 2-[(4S,4aS,7R,7aR,12bS)-4a,9-dihydroxy-3-prop-2-enyl-1,2,4,5,6,7,7a,13-octahydro-4,12-methanobenzofuro[3,2-e]isoquinolin-7-yl]-1,1-dioxo-1,2-benzothiazol-3-one |
| SMILES | C=CCN1CC[C@]23c4c5ccc(O)c4O[C@H]2[C@H](N2C(=O)c4ccccc4S2(=O)=O)CC[C@@]3(O)[C@@H]1C5 |
| InChI | InChI=1S/C26H26N2O6S/c1-2-12-27-13-11-25-21-15-7-8-18(29)22(21)34-23(25)17(9-10-26(25,31)20(27)14-15)28-24(30)16-5-3-4-6-19(16)35(28,32)33/h2-8,17,20,23,29,31H,1,9-14H2/t17-,20+,23+,25+,26-/m1/s1 |
| InChIKey | BGGSFNCURSGDEC-SAMTUFNXSA-N |
| XLogP | 1.95 |
| TPSA | 107.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.57 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|