C31H31FN2O11 — CID 69301034
2-[(4R,7R,7aR,12bS)-4a,9-dihydroxy-3-prop-2-enyl-1,2,4,5,6,7,7a,13-octahydro-4,12-methanobenzofuro[3,2-e]isoquinolin-7-yl]-4-fluoroisoindole-1,3-dione;2,3-dihydroxybutanedioic acid (PubChem CID 69301034) has the molecular formula C31H31FN2O11 and a molecular weight of 626.59 g/mol. Its IUPAC name is 2-[(4R,7R,7aR,12bS)-4a,9-dihydroxy-3-prop-2-enyl-1,2,4,5,6,7,7a,13-octahydro-4,12-methanobenzofuro[3,2-e]isoquinolin-7-yl]-4-fluoroisoindole-1,3-dione;2,3-dihydroxybutanedioic acid.
| Compound Name | 2-[(4R,7R,7aR,12bS)-4a,9-dihydroxy-3-prop-2-enyl-1,2,4,5,6,7,7a,13-octahydro-4,12-methanobenzofuro[3,2-e]isoquinolin-7-yl]-4-fluoroisoindole-1,3-dione;2,3-dihydroxybutanedioic acid |
|---|---|
| PubChem CID | 69301034 |
| Molecular Formula | C31H31FN2O11 |
| Molecular Weight | 626.59 g/mol |
| Exact Mass | 626.19 |
| IUPAC Name | 2-[(4R,7R,7aR,12bS)-4a,9-dihydroxy-3-prop-2-enyl-1,2,4,5,6,7,7a,13-octahydro-4,12-methanobenzofuro[3,2-e]isoquinolin-7-yl]-4-fluoroisoindole-1,3-dione;2,3-dihydroxybutanedioic acid |
| SMILES | C=CCN1CC[C@]23c4c5ccc(O)c4O[C@H]2[C@H](N2C(=O)c4cccc(F)c4C2=O)CCC3(O)[C@H]1C5.O=C(O)C(O)C(O)C(=O)O |
| InChI | InChI=1S/C27H25FN2O5.C4H6O6/c1-2-11-29-12-10-26-21-14-6-7-18(31)22(21)35-23(26)17(8-9-27(26,34)19(29)13-14)30-24(32)15-4-3-5-16(28)20(15)25(30)33;5-1(3(7)8)2(6)4(9)10/h2-7,17,19,23,31,34H,1,8-13H2;1-2,5-6H,(H,7,8)(H,9,10)/t17-,19-,23+,26+,27?;/m1./s1 |
| InChIKey | AXMPKVDWATUOTC-VPQIGVMYSA-N |
| XLogP | 0.41 |
| TPSA | 205.37 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 626.59 |
| LogP ≤ 5 | 0.41 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|