C27H27FN2O4 — CID 87773002
2-[(4R,4aS,7R,7aR,12bS)-4a,9-dihydroxy-3-prop-2-enyl-1,2,4,5,6,7,7a,13-octahydro-4,12-methanobenzofuro[3,2-e]isoquinolin-7-yl]-4-fluoro-3H-isoindol-1-one (PubChem CID 87773002) has the molecular formula C27H27FN2O4 and a molecular weight of 462.52 g/mol. Its IUPAC name is 2-[(4R,4aS,7R,7aR,12bS)-4a,9-dihydroxy-3-prop-2-enyl-1,2,4,5,6,7,7a,13-octahydro-4,12-methanobenzofuro[3,2-e]isoquinolin-7-yl]-4-fluoro-3H-isoindol-1-one.
| Compound Name | 2-[(4R,4aS,7R,7aR,12bS)-4a,9-dihydroxy-3-prop-2-enyl-1,2,4,5,6,7,7a,13-octahydro-4,12-methanobenzofuro[3,2-e]isoquinolin-7-yl]-4-fluoro-3H-isoindol-1-one |
|---|---|
| PubChem CID | 87773002 |
| Molecular Formula | C27H27FN2O4 |
| Molecular Weight | 462.52 g/mol |
| Exact Mass | 462.20 |
| IUPAC Name | 2-[(4R,4aS,7R,7aR,12bS)-4a,9-dihydroxy-3-prop-2-enyl-1,2,4,5,6,7,7a,13-octahydro-4,12-methanobenzofuro[3,2-e]isoquinolin-7-yl]-4-fluoro-3H-isoindol-1-one |
| SMILES | C=CCN1CC[C@]23c4c5ccc(O)c4O[C@H]2[C@H](N2Cc4c(F)cccc4C2=O)CC[C@@]3(O)[C@H]1C5 |
| InChI | InChI=1S/C27H27FN2O4/c1-2-11-29-12-10-26-22-15-6-7-20(31)23(22)34-24(26)19(8-9-27(26,33)21(29)13-15)30-14-17-16(25(30)32)4-3-5-18(17)28/h2-7,19,21,24,31,33H,1,8-14H2/t19-,21-,24+,26+,27-/m1/s1 |
| InChIKey | SMPFAGGOFYCKIX-XGTKUTNFSA-N |
| XLogP | 2.90 |
| TPSA | 73.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.52 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|