C22H32O3 — CID 87773269
(1S,2S,4R,5R,6S,9S,10S,11R,18R)-6-ethyl-6-hydroxy-5,11,18-trimethyl-3-oxapentacyclo[8.8.0.02,4.05,9.013,18]octadec-13-en-15-one (PubChem CID 87773269) has the molecular formula C22H32O3 and a molecular weight of 344.50 g/mol. Its IUPAC name is (1S,2S,4R,5R,6S,9S,10S,11R,18R)-6-ethyl-6-hydroxy-5,11,18-trimethyl-3-oxapentacyclo[8.8.0.02,4.05,9.013,18]octadec-13-en-15-one.
| Compound Name | (1S,2S,4R,5R,6S,9S,10S,11R,18R)-6-ethyl-6-hydroxy-5,11,18-trimethyl-3-oxapentacyclo[8.8.0.02,4.05,9.013,18]octadec-13-en-15-one |
|---|---|
| PubChem CID | 87773269 |
| Molecular Formula | C22H32O3 |
| Molecular Weight | 344.50 g/mol |
| Exact Mass | 344.24 |
| IUPAC Name | (1S,2S,4R,5R,6S,9S,10S,11R,18R)-6-ethyl-6-hydroxy-5,11,18-trimethyl-3-oxapentacyclo[8.8.0.02,4.05,9.013,18]octadec-13-en-15-one |
| SMILES | CC[C@]1(O)CC[C@H]2[C@H]3[C@H]([C@@H]4O[C@@H]4[C@@]21C)[C@@]1(C)CCC(=O)C=C1C[C@H]3C |
| InChI | InChI=1S/C22H32O3/c1-5-22(24)9-7-15-16-12(2)10-13-11-14(23)6-8-20(13,3)17(16)18-19(25-18)21(15,22)4/h11-12,15-19,24H,5-10H2,1-4H3/t12-,15+,16+,17-,18+,19+,20+,21-,22+/m1/s1 |
| InChIKey | IQJBVFVURRRSFP-IALBTZRBSA-N |
| XLogP | 3.89 |
| TPSA | 49.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.50 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|