About 2-(2-methoxyphenyl)-1,3-selenazole
2-(2-methoxyphenyl)-1,3-selenazole (PubChem CID 87779357) has the molecular formula C10H9NOSe
and a molecular weight of 238.15 g/mol. Its IUPAC name is 2-(2-methoxyphenyl)-1,3-selenazole.
Molecular Properties
| Compound Name | 2-(2-methoxyphenyl)-1,3-selenazole |
| PubChem CID | 87779357 |
| Molecular Formula | C10H9NOSe |
| Molecular Weight | 238.15 g/mol |
| Exact Mass | 238.98 |
| IUPAC Name | 2-(2-methoxyphenyl)-1,3-selenazole |
| SMILES | COc1ccccc1-c1ncc[se]1 |
| InChI | InChI=1S/C10H9NOSe/c1-12-9-5-3-2-4-8(9)10-11-6-7-13-10/h2-7H,1H3 |
| InChIKey | SLNMSYHCIUEFCI-UHFFFAOYSA-N |
| XLogP | 1.81 |
| TPSA | 22.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 238.15 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze 2-(2-methoxyphenyl)-1,3-selenazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(2-methoxyphenyl)-1,3-selenazole?
The IUPAC name of 2-(2-methoxyphenyl)-1,3-selenazole (CID 87779357) is 2-(2-methoxyphenyl)-1,3-selenazole.
What is the SMILES notation for 2-(2-methoxyphenyl)-1,3-selenazole?
The canonical SMILES for 2-(2-methoxyphenyl)-1,3-selenazole is COc1ccccc1-c1ncc[se]1.
What is the InChIKey of 2-(2-methoxyphenyl)-1,3-selenazole?
The InChIKey is SLNMSYHCIUEFCI-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H9NOSe/c1-12-9-5-3-2-4-8(9)10-11-6-7-13-10/h2-7H,1H3.
What are the key properties of 2-(2-methoxyphenyl)-1,3-selenazole?
2-(2-methoxyphenyl)-1,3-selenazole has a molecular weight of 238.15 g/mol, XLogP of 1.81, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(2-methoxyphenyl)-1,3-selenazole is sourced from PubChem (CID 87779357), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).