About cesium 2-methoxyphenolate
cesium 2-methoxyphenolate (PubChem CID 23674354) has the molecular formula C7H7CsO2
and a molecular weight of 256.04 g/mol. Its IUPAC name is cesium 2-methoxyphenolate.
Molecular Properties
| Compound Name | cesium 2-methoxyphenolate |
| PubChem CID | 23674354 |
| Molecular Formula | C7H7CsO2 |
| Molecular Weight | 256.04 g/mol |
| Exact Mass | 255.95 |
| IUPAC Name | cesium 2-methoxyphenolate |
| SMILES | COc1ccccc1[O-].[Cs+] |
| InChI | InChI=1S/C7H8O2.Cs/c1-9-7-5-3-2-4-6(7)8;/h2-5,8H,1H3;/q;+1/p-1 |
| InChIKey | XIPSHVDSLMAQNR-UHFFFAOYSA-M |
| XLogP | -2.23 |
| TPSA | 32.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 256.04 |
| LogP ≤ 5 | -2.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze cesium 2-methoxyphenolate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of cesium 2-methoxyphenolate?
The IUPAC name of cesium 2-methoxyphenolate (CID 23674354) is cesium 2-methoxyphenolate.
What is the SMILES notation for cesium 2-methoxyphenolate?
The canonical SMILES for cesium 2-methoxyphenolate is COc1ccccc1[O-].[Cs+].
What is the InChIKey of cesium 2-methoxyphenolate?
The InChIKey is XIPSHVDSLMAQNR-UHFFFAOYSA-M. The full InChI is InChI=1S/C7H8O2.Cs/c1-9-7-5-3-2-4-6(7)8;/h2-5,8H,1H3;/q;+1/p-1.
What are the key properties of cesium 2-methoxyphenolate?
cesium 2-methoxyphenolate has a molecular weight of 256.04 g/mol, XLogP of -2.23, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for cesium 2-methoxyphenolate is sourced from PubChem (CID 23674354), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).