C18H24ClN3O5 — CID 87779497
3-chloro-4-[(2S)-2-[[(2-methylpropan-2-yl)oxycarbonylamino]methylamino]pyrrolidine-1-carbonyl]benzoic acid (PubChem CID 87779497) has the molecular formula C18H24ClN3O5 and a molecular weight of 397.86 g/mol. Its IUPAC name is 3-chloro-4-[(2S)-2-[[(2-methylpropan-2-yl)oxycarbonylamino]methylamino]pyrrolidine-1-carbonyl]benzoic acid.
| Compound Name | 3-chloro-4-[(2S)-2-[[(2-methylpropan-2-yl)oxycarbonylamino]methylamino]pyrrolidine-1-carbonyl]benzoic acid |
|---|---|
| PubChem CID | 87779497 |
| Molecular Formula | C18H24ClN3O5 |
| Molecular Weight | 397.86 g/mol |
| Exact Mass | 397.14 |
| IUPAC Name | 3-chloro-4-[(2S)-2-[[(2-methylpropan-2-yl)oxycarbonylamino]methylamino]pyrrolidine-1-carbonyl]benzoic acid |
| SMILES | CC(C)(C)OC(=O)NCN[C@@H]1CCCN1C(=O)c1ccc(C(=O)O)cc1Cl |
| InChI | InChI=1S/C18H24ClN3O5/c1-18(2,3)27-17(26)21-10-20-14-5-4-8-22(14)15(23)12-7-6-11(16(24)25)9-13(12)19/h6-7,9,14,20H,4-5,8,10H2,1-3H3,(H,21,26)(H,24,25)/t14-/m0/s1 |
| InChIKey | MCBUDUWDICWBES-AWEZNQCLSA-N |
| XLogP | 2.67 |
| TPSA | 107.97 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.86 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|