About zinc;N-octadecyl-N-propan-2-ylcarbamothioate;carbamothioate
zinc;N-octadecyl-N-propan-2-ylcarbamothioate;carbamothioate (PubChem CID 87780648) has the molecular formula C23H46N2O2S2Zn
and a molecular weight of 512.16 g/mol. Its IUPAC name is zinc;N-octadecyl-N-propan-2-ylcarbamothioate;carbamothioate.
Molecular Properties
| Compound Name | zinc;N-octadecyl-N-propan-2-ylcarbamothioate;carbamothioate |
| PubChem CID | 87780648 |
| Molecular Formula | C23H46N2O2S2Zn |
| Molecular Weight | 512.16 g/mol |
| Exact Mass | 510.23 |
| IUPAC Name | zinc;N-octadecyl-N-propan-2-ylcarbamothioate;carbamothioate |
| SMILES | CCCCCCCCCCCCCCCCCCN(C(=O)[S-])C(C)C.NC(=O)[S-].[Zn+2] |
| InChI | InChI=1S/C22H45NOS.CH3NOS.Zn/c1-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-20-23(21(2)3)22(24)25;2-1(3)4;/h21H,4-20H2,1-3H3,(H,24,25);(H3,2,3,4);/q;;+2/p-2 |
| InChIKey | VXTFUJBOSUAAHE-UHFFFAOYSA-L |
| XLogP | 7.23 |
| TPSA | 63.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 512.16 |
| LogP ≤ 5 | 7.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'}, {'alert_name': 'thiol_1', 'substructure': 'N/A'} |
|---|
Analyze zinc;N-octadecyl-N-propan-2-ylcarbamothioate;carbamothioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of zinc;N-octadecyl-N-propan-2-ylcarbamothioate;carbamothioate?
The IUPAC name of zinc;N-octadecyl-N-propan-2-ylcarbamothioate;carbamothioate (CID 87780648) is zinc;N-octadecyl-N-propan-2-ylcarbamothioate;carbamothioate.
What is the SMILES notation for zinc;N-octadecyl-N-propan-2-ylcarbamothioate;carbamothioate?
The canonical SMILES for zinc;N-octadecyl-N-propan-2-ylcarbamothioate;carbamothioate is CCCCCCCCCCCCCCCCCCN(C(=O)[S-])C(C)C.NC(=O)[S-].[Zn+2].
What is the InChIKey of zinc;N-octadecyl-N-propan-2-ylcarbamothioate;carbamothioate?
The InChIKey is VXTFUJBOSUAAHE-UHFFFAOYSA-L. The full InChI is InChI=1S/C22H45NOS.CH3NOS.Zn/c1-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-20-23(21(2)3)22(24)25;2-1(3)4;/h21H,4-20H2,1-3H3,(H,24,25);(H3,2,3,4);/q;;+2/p-2.
What are the key properties of zinc;N-octadecyl-N-propan-2-ylcarbamothioate;carbamothioate?
zinc;N-octadecyl-N-propan-2-ylcarbamothioate;carbamothioate has a molecular weight of 512.16 g/mol, XLogP of 7.23, 18 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for zinc;N-octadecyl-N-propan-2-ylcarbamothioate;carbamothioate is sourced from PubChem (CID 87780648), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).