C18H15F3N2O3 — CID 87780735
N-[2-oxo-1-[3-(trifluoromethoxy)phenyl]pyrrolidin-3-yl]-N-phenylformamide (PubChem CID 87780735) has the molecular formula C18H15F3N2O3 and a molecular weight of 364.32 g/mol. Its IUPAC name is N-[2-oxo-1-[3-(trifluoromethoxy)phenyl]pyrrolidin-3-yl]-N-phenylformamide.
| Compound Name | N-[2-oxo-1-[3-(trifluoromethoxy)phenyl]pyrrolidin-3-yl]-N-phenylformamide |
|---|---|
| PubChem CID | 87780735 |
| Molecular Formula | C18H15F3N2O3 |
| Molecular Weight | 364.32 g/mol |
| Exact Mass | 364.10 |
| IUPAC Name | N-[2-oxo-1-[3-(trifluoromethoxy)phenyl]pyrrolidin-3-yl]-N-phenylformamide |
| SMILES | O=CN(c1ccccc1)C1CCN(c2cccc(OC(F)(F)F)c2)C1=O |
| InChI | InChI=1S/C18H15F3N2O3/c19-18(20,21)26-15-8-4-7-14(11-15)22-10-9-16(17(22)25)23(12-24)13-5-2-1-3-6-13/h1-8,11-12,16H,9-10H2 |
| InChIKey | MKLKXSMGDMROFB-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 49.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.32 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|