C16H14Cl3N3 — CID 87781271
4-chloro-7-(2,4-dichlorophenyl)-2-methyl-5-prop-2-enyl-5,6-dihydropyrrolo[2,3-d]pyrimidine (PubChem CID 87781271) has the molecular formula C16H14Cl3N3 and a molecular weight of 354.67 g/mol. Its IUPAC name is 4-chloro-7-(2,4-dichlorophenyl)-2-methyl-5-prop-2-enyl-5,6-dihydropyrrolo[2,3-d]pyrimidine.
| Compound Name | 4-chloro-7-(2,4-dichlorophenyl)-2-methyl-5-prop-2-enyl-5,6-dihydropyrrolo[2,3-d]pyrimidine |
|---|---|
| PubChem CID | 87781271 |
| Molecular Formula | C16H14Cl3N3 |
| Molecular Weight | 354.67 g/mol |
| Exact Mass | 353.03 |
| IUPAC Name | 4-chloro-7-(2,4-dichlorophenyl)-2-methyl-5-prop-2-enyl-5,6-dihydropyrrolo[2,3-d]pyrimidine |
| SMILES | C=CCC1CN(c2ccc(Cl)cc2Cl)c2nc(C)nc(Cl)c21 |
| InChI | InChI=1S/C16H14Cl3N3/c1-3-4-10-8-22(13-6-5-11(17)7-12(13)18)16-14(10)15(19)20-9(2)21-16/h3,5-7,10H,1,4,8H2,2H3 |
| InChIKey | HJXNYBIGPBTNOV-UHFFFAOYSA-N |
| XLogP | 5.56 |
| TPSA | 29.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.67 |
| LogP ≤ 5 | 5.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|