C22H33ClN2 — CID 143002899
4-[(1R)-6-chloro-3-prop-2-enyl-2,3-dihydro-1H-inden-1-yl]-1,2,2-trimethylpiperazine;prop-1-ene (PubChem CID 143002899) has the molecular formula C22H33ClN2 and a molecular weight of 360.97 g/mol. Its IUPAC name is 4-[(1R)-6-chloro-3-prop-2-enyl-2,3-dihydro-1H-inden-1-yl]-1,2,2-trimethylpiperazine;prop-1-ene.
| Compound Name | 4-[(1R)-6-chloro-3-prop-2-enyl-2,3-dihydro-1H-inden-1-yl]-1,2,2-trimethylpiperazine;prop-1-ene |
|---|---|
| PubChem CID | 143002899 |
| Molecular Formula | C22H33ClN2 |
| Molecular Weight | 360.97 g/mol |
| Exact Mass | 360.23 |
| IUPAC Name | 4-[(1R)-6-chloro-3-prop-2-enyl-2,3-dihydro-1H-inden-1-yl]-1,2,2-trimethylpiperazine;prop-1-ene |
| SMILES | C=CC.C=CCC1C[C@@H](N2CCN(C)C(C)(C)C2)c2cc(Cl)ccc21 |
| InChI | InChI=1S/C19H27ClN2.C3H6/c1-5-6-14-11-18(17-12-15(20)7-8-16(14)17)22-10-9-21(4)19(2,3)13-22;1-3-2/h5,7-8,12,14,18H,1,6,9-11,13H2,2-4H3;3H,1H2,2H3/t14?,18-;/m1./s1 |
| InChIKey | CIWSHGJGBMGBPU-HYQBYDJKSA-N |
| XLogP | 5.66 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.97 |
| LogP ≤ 5 | 5.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|