C47H58Cl2N4O4 — CID 140511929
bis(4-[(1R,3S)-6-chloro-3-phenyl-2,3-dihydro-1H-inden-1-yl]-1,2,2-trimethylpiperazin-1-ium);propanedioate (PubChem CID 140511929) has the molecular formula C47H58Cl2N4O4 and a molecular weight of 813.91 g/mol. Its IUPAC name is bis(4-[(1R,3S)-6-chloro-3-phenyl-2,3-dihydro-1H-inden-1-yl]-1,2,2-trimethylpiperazin-1-ium);propanedioate.
| Compound Name | bis(4-[(1R,3S)-6-chloro-3-phenyl-2,3-dihydro-1H-inden-1-yl]-1,2,2-trimethylpiperazin-1-ium);propanedioate |
|---|---|
| PubChem CID | 140511929 |
| Molecular Formula | C47H58Cl2N4O4 |
| Molecular Weight | 813.91 g/mol |
| Exact Mass | 812.38 |
| IUPAC Name | bis(4-[(1R,3S)-6-chloro-3-phenyl-2,3-dihydro-1H-inden-1-yl]-1,2,2-trimethylpiperazin-1-ium);propanedioate |
| SMILES | C[NH+]1CCN([C@@H]2C[C@@H](c3ccccc3)c3ccc(Cl)cc32)CC1(C)C.C[NH+]1CCN([C@@H]2C[C@@H](c3ccccc3)c3ccc(Cl)cc32)CC1(C)C.O=C([O-])CC(=O)[O-] |
| InChI | InChI=1S/2C22H27ClN2.C3H4O4/c2*1-22(2)15-25(12-11-24(22)3)21-14-19(16-7-5-4-6-8-16)18-10-9-17(23)13-20(18)21;4-2(5)1-3(6)7/h2*4-10,13,19,21H,11-12,14-15H2,1-3H3;1H2,(H,4,5)(H,6,7)/t2*19-,21+;/m00./s1 |
| InChIKey | RLBFAFNYZPGQNF-YFEJGKDJSA-N |
| XLogP | 3.93 |
| TPSA | 95.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 57 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 813.91 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|